|
Phospholipids |
|
|
A phospholipid molecule consists of a hydrophilic polar head group and a hydrophobic tail. The polar head group contains one or more phosphate groups. The hydrophobic tail is made up of two fatty acyl chains. When many phospholipid molecules are placed in water, their hydrophilic heads tend to face water and the hydrophobic tails are forced to stick together, forming a bilayer. (a)
|
| Chemical Formula | Name |
| Saturated fatty acid | |
| CH3(CH2)10COOH | Lauric |
| CH3(CH2)12COOH | Myristic |
| CH3(CH2)14COOH | Palmitic |
| CH3(CH2)16COOH | Stearic |
| CH3(CH2)18COOH | Arachidic |
| CH3(CH2)22COOH | Lignoceric |
| Unsaturated fatty acid | |
| CH3(CH2)5CH=CH(CH2)7COOH | Palmitoleic |
| CH3(CH2)7CH=CH(CH2)7COOH | Oleic |
| CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH | Linoleic |
| CH3(CH2)4(CH=CHCH2)3CH=CH(CH2)3COOH | Arachidonic |
| CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH | Linolenic |
Note: In the bond-line representation,
Palmitic acid is represented as
![]()
Arachidonic acid is represented as
![]()
Review Articles:
The Biochemistry of n-3 Polyunsaturated Fatty Acids - J. Biol. Chem., 2001.
Sphingolipid Metabolism and Signaling - J. Biol. Chem., 2002.